docs: consolidate documentation into organized structure

- Move 12 markdown files from root to docs/ subdirectories
- Organize documentation by category:
  • docs/troubleshooting/ (1 file)  - Technical troubleshooting guides
  • docs/deployment/      (4 files) - Deployment and security documentation
  • docs/guides/          (3 files) - Feature-specific guides
  • docs/planning/        (4 files) - Planning and improvement proposals

Root directory cleanup:
- Reduced from 16 to 4 markdown files in root
- Only essential project files remain:
  • CLAUDE.md (AI instructions)
  • README.md (Main project readme)
  • CLEANUP_PLAN.md (Current cleanup plan)
  • SRC_STRUCTURE_IMPROVEMENTS.md (Structure improvements)

This improves:
✅ Documentation discoverability
✅ Logical organization by purpose
✅ Clean root directory
✅ Better maintainability

tests/Framework/Discovery/Processing/ClassExtractorTest.php

@@ -0,0 +1,198 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Framework\Discovery\Processing\ClassExtractor;
+use App\Framework\Filesystem\File;
+use App\Framework\Filesystem\FilePath;
+use App\Framework\Filesystem\FileSystemService;
+
+beforeEach(function () {
+    $this->fileSystem = new FileSystemService();
+    $this->extractor = new ClassExtractor($this->fileSystem);
+    $this->tmpDir = '/var/www/html/tests/tmp';
+
+    if (!is_dir($this->tmpDir)) {
+        mkdir($this->tmpDir, 0777, true);
+    }
+
+    $this->createTestFile = function (string $filename, string $content): File {
+        $filepath = $this->tmpDir . '/' . $filename;
+        file_put_contents($filepath, $content);
+
+        $spl = new SplFileInfo($filepath);
+        return File::fromSplFileInfo($spl);
+    };
+});
+
+afterEach(function () {
+    // Clean up test files
+    if (is_dir($this->tmpDir)) {
+        $files = glob($this->tmpDir . '/*');
+        foreach ($files as $file) {
+            if (is_file($file)) {
+                unlink($file);
+            }
+        }
+    }
+});
+
+describe('ClassExtractor', function () {
+    it('extracts classes from PHP file', function () {
+        $content = <<<'PHP'
+<?php
+
+namespace App\Test;
+
+final readonly class TestClass
+{
+    public function test(): void {}
+}
+PHP;
+
+        $file = ($this->createTestFile)('TestClass.php', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(1);
+        expect($classes[0]->getFullyQualified())->toBe('App\Test\TestClass');
+    });
+
+    it('returns empty array for HTML template files without PHP tags', function () {
+        $content = <<<'HTML'
+<layout name="layouts/main" />
+
+<div class="section">
+    <h2>Dashboard</h2>
+    <div class="stats-grid">
+        <div class="stat-card">
+            <h3>Status</h3>
+        </div>
+    </div>
+</div>
+HTML;
+
+        $file = ($this->createTestFile)('template.view.php', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(0);
+    });
+
+    it('extracts multiple classes from file', function () {
+        $content = <<<'PHP'
+<?php
+
+namespace App\Test;
+
+interface TestInterface {}
+
+final readonly class TestClass implements TestInterface {}
+
+trait TestTrait {}
+
+enum TestEnum {
+    case CASE_ONE;
+}
+PHP;
+
+        $file = ($this->createTestFile)('Multiple.php', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(4);
+    });
+
+    it('handles files with short PHP tags', function () {
+        $content = <<<'PHP'
+<?= "test" ?>
+<?php
+
+class ShortTagTest {}
+PHP;
+
+        $file = ($this->createTestFile)('ShortTag.php', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(1);
+    });
+
+    it('extracts detailed class information', function () {
+        $content = <<<'PHP'
+<?php
+
+namespace App\Test;
+
+final readonly class DetailedClass
+{
+    public function method(): void {}
+}
+PHP;
+
+        $file = ($this->createTestFile)('Detailed.php', $content);
+        $detailed = $this->extractor->extractDetailedFromFile($file);
+
+        expect($detailed)->toHaveCount(1);
+        expect($detailed[0]['type'])->toBe('class');
+        expect($detailed[0]['name'])->toBe('DetailedClass');
+        expect($detailed[0]['namespace'])->toBe('App\Test');
+        expect($detailed[0]['fqn'])->toBe('App\Test\DetailedClass');
+    });
+
+    it('returns empty array for files with syntax errors', function () {
+        $content = <<<'PHP'
+<?php
+
+class InvalidClass {
+    // Missing closing brace
+PHP;
+
+        $file = ($this->createTestFile)('Invalid.php', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(0);
+    });
+
+    it('analyzes complete file structure', function () {
+        $content = <<<'PHP'
+<?php
+
+namespace App\Test;
+
+use App\Framework\Core\Application;
+
+final readonly class AnalysisTest
+{
+    public function __construct(
+        private Application $app
+    ) {}
+}
+PHP;
+
+        $file = ($this->createTestFile)('Analysis.php', $content);
+        $analysis = $this->extractor->analyzeFile($file);
+
+        expect($analysis)->toHaveKeys(['classes', 'functions', 'attributes', 'uses']);
+        expect($analysis['classes'])->toHaveCount(1);
+        expect($analysis['uses'])->toHaveCount(1);
+    });
+
+    it('does not extract from pure HTML without PHP tags', function () {
+        $content = <<<'HTML'
+<!DOCTYPE html>
+<html>
+<head>
+    <title>Test</title>
+</head>
+<body>
+    <div class="container">
+        <h1>Title</h1>
+    </div>
+</body>
+</html>
+HTML;
+
+        $file = ($this->createTestFile)('pure.html', $content);
+        $classes = $this->extractor->extractFromFile($file);
+
+        expect($classes)->toHaveCount(0);
+    });
+});
+